C17H18O3 — CID 88838673
4-(4-hydroxyphenyl)-4-(3-methoxyphenyl)butanal (PubChem CID 88838673) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-4-(3-methoxyphenyl)butanal.
| Compound Name | 4-(4-hydroxyphenyl)-4-(3-methoxyphenyl)butanal |
|---|---|
| PubChem CID | 88838673 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 4-(4-hydroxyphenyl)-4-(3-methoxyphenyl)butanal |
| SMILES | COc1cccc(C(CCC=O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C17H18O3/c1-20-16-5-2-4-14(12-16)17(6-3-11-18)13-7-9-15(19)10-8-13/h2,4-5,7-12,17,19H,3,6H2,1H3 |
| InChIKey | TVQUCYAQEUZXSW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|