About 3-aminoazepan-2-one;nickel
3-aminoazepan-2-one;nickel (PubChem CID 88838711) has the molecular formula C6H12N2NiO
and a molecular weight of 186.87 g/mol. Its IUPAC name is 3-aminoazepan-2-one;nickel.
Molecular Properties
| Compound Name | 3-aminoazepan-2-one;nickel |
| PubChem CID | 88838711 |
| Molecular Formula | C6H12N2NiO |
| Molecular Weight | 186.87 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 3-aminoazepan-2-one;nickel |
| SMILES | NC1CCCCNC1=O.[Ni] |
| InChI | InChI=1S/C6H12N2O.Ni/c7-5-3-1-2-4-8-6(5)9;/h5H,1-4,7H2,(H,8,9); |
| InChIKey | KOYMTYKIGCLLHY-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.87 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-aminoazepan-2-one;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminoazepan-2-one;nickel?
The IUPAC name of 3-aminoazepan-2-one;nickel (CID 88838711) is 3-aminoazepan-2-one;nickel.
What is the SMILES notation for 3-aminoazepan-2-one;nickel?
The canonical SMILES for 3-aminoazepan-2-one;nickel is NC1CCCCNC1=O.[Ni].
What is the InChIKey of 3-aminoazepan-2-one;nickel?
The InChIKey is KOYMTYKIGCLLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.Ni/c7-5-3-1-2-4-8-6(5)9;/h5H,1-4,7H2,(H,8,9);.
What are the key properties of 3-aminoazepan-2-one;nickel?
3-aminoazepan-2-one;nickel has a molecular weight of 186.87 g/mol, XLogP of -0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminoazepan-2-one;nickel is sourced from PubChem (CID 88838711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).