About 2-hydroxybutanedial;propane
2-hydroxybutanedial;propane (PubChem CID 88838865) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-hydroxybutanedial;propane.
Molecular Properties
| Compound Name | 2-hydroxybutanedial;propane |
| PubChem CID | 88838865 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 2-hydroxybutanedial;propane |
| SMILES | CCC.O=CCC(O)C=O |
| InChI | InChI=1S/C4H6O3.C3H8/c5-2-1-4(7)3-6;1-3-2/h2-4,7H,1H2;3H2,1-2H3 |
| InChIKey | BEPKBCGFDPMPQW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybutanedial;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanedial;propane?
The IUPAC name of 2-hydroxybutanedial;propane (CID 88838865) is 2-hydroxybutanedial;propane.
What is the SMILES notation for 2-hydroxybutanedial;propane?
The canonical SMILES for 2-hydroxybutanedial;propane is CCC.O=CCC(O)C=O.
What is the InChIKey of 2-hydroxybutanedial;propane?
The InChIKey is BEPKBCGFDPMPQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.C3H8/c5-2-1-4(7)3-6;1-3-2/h2-4,7H,1H2;3H2,1-2H3.
What are the key properties of 2-hydroxybutanedial;propane?
2-hydroxybutanedial;propane has a molecular weight of 146.19 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanedial;propane is sourced from PubChem (CID 88838865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).