C9H14O4 — CID 88839304
(2S,3aS,4S,5S,6aR)-5-hydroxy-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-carbaldehyde (PubChem CID 88839304) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (2S,3aS,4S,5S,6aR)-5-hydroxy-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-carbaldehyde.
| Compound Name | (2S,3aS,4S,5S,6aR)-5-hydroxy-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-carbaldehyde |
|---|---|
| PubChem CID | 88839304 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (2S,3aS,4S,5S,6aR)-5-hydroxy-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-carbaldehyde |
| SMILES | CO[C@@H]1C[C@H]2[C@H](C=O)[C@@H](O)C[C@H]2O1 |
| InChI | InChI=1S/C9H14O4/c1-12-9-2-5-6(4-10)7(11)3-8(5)13-9/h4-9,11H,2-3H2,1H3/t5-,6-,7-,8+,9-/m0/s1 |
| InChIKey | BZLWKUPYKKOOHV-XRBOHMRVSA-N |
| XLogP | -0.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|