About 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine
2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine (PubChem CID 88839526) has the molecular formula C5H12N4
and a molecular weight of 128.18 g/mol. Its IUPAC name is 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine.
Molecular Properties
| Compound Name | 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine |
| PubChem CID | 88839526 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine |
| SMILES | C1CN=C2NC2C1.NN |
| InChI | InChI=1S/C5H8N2.H4N2/c1-2-4-5(7-4)6-3-1;1-2/h4H,1-3H2,(H,6,7);1-2H2 |
| InChIKey | ZULMJUGXMVGVHB-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine?
The IUPAC name of 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine (CID 88839526) is 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine.
What is the SMILES notation for 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine?
The canonical SMILES for 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine is C1CN=C2NC2C1.NN.
What is the InChIKey of 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine?
The InChIKey is ZULMJUGXMVGVHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.H4N2/c1-2-4-5(7-4)6-3-1;1-2/h4H,1-3H2,(H,6,7);1-2H2.
What are the key properties of 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine?
2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine has a molecular weight of 128.18 g/mol, XLogP of -1.03, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diazabicyclo[4.1.0]hept-1-ene;hydrazine is sourced from PubChem (CID 88839526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).