About magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide
magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide (PubChem CID 88839743) has the molecular formula C9H9BrMgN2
and a molecular weight of 249.39 g/mol. Its IUPAC name is magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide.
Molecular Properties
| Compound Name | magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide |
| PubChem CID | 88839743 |
| Molecular Formula | C9H9BrMgN2 |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide |
| SMILES | [Br-].[Mg+2].[c-]1ccc(C2CN=CN2)cc1 |
| InChI | InChI=1S/C9H9N2.BrH.Mg/c1-2-4-8(5-3-1)9-6-10-7-11-9;;/h2-5,7,9H,6H2,(H,10,11);1H;/q-1;;+2/p-1 |
| InChIKey | JCNNFSFDXWTZGT-UHFFFAOYSA-M |
| XLogP | -2.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide?
The IUPAC name of magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide (CID 88839743) is magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide.
What is the SMILES notation for magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide?
The canonical SMILES for magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide is [Br-].[Mg+2].[c-]1ccc(C2CN=CN2)cc1.
What is the InChIKey of magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide?
The InChIKey is JCNNFSFDXWTZGT-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H9N2.BrH.Mg/c1-2-4-8(5-3-1)9-6-10-7-11-9;;/h2-5,7,9H,6H2,(H,10,11);1H;/q-1;;+2/p-1.
What are the key properties of magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide?
magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide has a molecular weight of 249.39 g/mol, XLogP of -2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;5-phenyl-4,5-dihydro-1H-imidazole;bromide is sourced from PubChem (CID 88839743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).