About 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid
2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid (PubChem CID 88840087) has the molecular formula C17H22Cl3NO3
and a molecular weight of 394.73 g/mol. Its IUPAC name is 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid.
Molecular Properties
| Compound Name | 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid |
| PubChem CID | 88840087 |
| Molecular Formula | C17H22Cl3NO3 |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid |
| SMILES | CCCCCC(=O)Nc1c(Cl)cc(Cl)c(CC(CC)C(=O)O)c1Cl |
| InChI | InChI=1S/C17H22Cl3NO3/c1-3-5-6-7-14(22)21-16-13(19)9-12(18)11(15(16)20)8-10(4-2)17(23)24/h9-10H,3-8H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | LSOVVFMHNLLOFR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid?
The IUPAC name of 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid (CID 88840087) is 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid.
What is the SMILES notation for 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid?
The canonical SMILES for 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid is CCCCCC(=O)Nc1c(Cl)cc(Cl)c(CC(CC)C(=O)O)c1Cl.
What is the InChIKey of 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid?
The InChIKey is LSOVVFMHNLLOFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22Cl3NO3/c1-3-5-6-7-14(22)21-16-13(19)9-12(18)11(15(16)20)8-10(4-2)17(23)24/h9-10H,3-8H2,1-2H3,(H,21,22)(H,23,24).
What are the key properties of 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid?
2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid has a molecular weight of 394.73 g/mol, XLogP of 5.82, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,4,6-trichloro-3-(hexanoylamino)phenyl]methyl]butanoic acid is sourced from PubChem (CID 88840087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).