About 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine
5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine (PubChem CID 88840642) has the molecular formula C26H22N4
and a molecular weight of 390.49 g/mol. Its IUPAC name is 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine |
| PubChem CID | 88840642 |
| Molecular Formula | C26H22N4 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine |
| SMILES | C#Cc1c(N)c(N)cc(-c2cc(N)c(N)cc2-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H22N4/c1-2-18-25(17-11-7-4-8-12-17)21(15-24(29)26(18)30)20-14-23(28)22(27)13-19(20)16-9-5-3-6-10-16/h1,3-15H,27-30H2 |
| InChIKey | YNMWHOJUCGNPJI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine?
The IUPAC name of 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine (CID 88840642) is 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine.
What is the SMILES notation for 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine?
The canonical SMILES for 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine is C#Cc1c(N)c(N)cc(-c2cc(N)c(N)cc2-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine?
The InChIKey is YNMWHOJUCGNPJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N4/c1-2-18-25(17-11-7-4-8-12-17)21(15-24(29)26(18)30)20-14-23(28)22(27)13-19(20)16-9-5-3-6-10-16/h1,3-15H,27-30H2.
What are the key properties of 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine?
5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine has a molecular weight of 390.49 g/mol, XLogP of 5.00, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-diamino-2-phenylphenyl)-3-ethynyl-4-phenylbenzene-1,2-diamine is sourced from PubChem (CID 88840642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).