C32H34O4S2 — CID 88840751
2,3-bis[(3-hydroxy-2,6-dimethyl-4-prop-2-enylphenyl)methyl]benzene-1,4-dicarbothioic S-acid (PubChem CID 88840751) has the molecular formula C32H34O4S2 and a molecular weight of 546.75 g/mol. Its IUPAC name is 2,3-bis[(3-hydroxy-2,6-dimethyl-4-prop-2-enylphenyl)methyl]benzene-1,4-dicarbothioic S-acid.
| Compound Name | 2,3-bis[(3-hydroxy-2,6-dimethyl-4-prop-2-enylphenyl)methyl]benzene-1,4-dicarbothioic S-acid |
|---|---|
| PubChem CID | 88840751 |
| Molecular Formula | C32H34O4S2 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 2,3-bis[(3-hydroxy-2,6-dimethyl-4-prop-2-enylphenyl)methyl]benzene-1,4-dicarbothioic S-acid |
| SMILES | C=CCc1cc(C)c(Cc2c(C(=O)S)ccc(C(=O)S)c2Cc2c(C)cc(CC=C)c(O)c2C)c(C)c1O |
| InChI | InChI=1S/C32H34O4S2/c1-7-9-21-13-17(3)25(19(5)29(21)33)15-27-23(31(35)37)11-12-24(32(36)38)28(27)16-26-18(4)14-22(10-8-2)30(34)20(26)6/h7-8,11-14,33-34H,1-2,9-10,15-16H2,3-6H3,(H,35,37)(H,36,38) |
| InChIKey | ZXHZJQQGTDJPIV-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|