C31H26N2O4S2 — CID 88840798
11-[7-(10,12-dioxo-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraen-11-yl)heptyl]-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraene-10,12-dione (PubChem CID 88840798) has the molecular formula C31H26N2O4S2 and a molecular weight of 554.69 g/mol. Its IUPAC name is 11-[7-(10,12-dioxo-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraen-11-yl)heptyl]-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraene-10,12-dione.
| Compound Name | 11-[7-(10,12-dioxo-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraen-11-yl)heptyl]-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 88840798 |
| Molecular Formula | C31H26N2O4S2 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | 11-[7-(10,12-dioxo-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraen-11-yl)heptyl]-13-sulfanylidene-11-azatricyclo[7.3.1.02,7]trideca-2,4,6,8-tetraene-10,12-dione |
| SMILES | O=C1C2=Cc3ccccc3C(C(=O)N1CCCCCCCN1C(=O)C3=Cc4ccccc4C(C1=O)C3=S)C2=S |
| InChI | InChI=1S/C31H26N2O4S2/c34-28-22-16-18-10-4-6-12-20(18)24(26(22)38)30(36)32(28)14-8-2-1-3-9-15-33-29(35)23-17-19-11-5-7-13-21(19)25(27(23)39)31(33)37/h4-7,10-13,16-17,24-25H,1-3,8-9,14-15H2 |
| InChIKey | GLWUPIOBEYXKGA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|