C11H12Cl2O3 — CID 88840980
(3Z,8Z)-4,8-dichloroundeca-3,8-diene-5,6,7-trione (PubChem CID 88840980) has the molecular formula C11H12Cl2O3 and a molecular weight of 263.12 g/mol. Its IUPAC name is (3Z,8Z)-4,8-dichloroundeca-3,8-diene-5,6,7-trione.
| Compound Name | (3Z,8Z)-4,8-dichloroundeca-3,8-diene-5,6,7-trione |
|---|---|
| PubChem CID | 88840980 |
| Molecular Formula | C11H12Cl2O3 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (3Z,8Z)-4,8-dichloroundeca-3,8-diene-5,6,7-trione |
| SMILES | CC/C=C(\Cl)C(=O)C(=O)C(=O)/C(Cl)=C/CC |
| InChI | InChI=1S/C11H12Cl2O3/c1-3-5-7(12)9(14)11(16)10(15)8(13)6-4-2/h5-6H,3-4H2,1-2H3/b7-5-,8-6- |
| InChIKey | FMAKYJVXXPSLRI-SFECMWDFSA-N |
| XLogP | 2.76 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|