C15H13F2N3O2 — CID 8884138
N-[(Z)-1-(2,4-difluorophenyl)ethylideneamino]-2-(2-oxo-1-pyridinyl)acetamide (PubChem CID 8884138) has the molecular formula C15H13F2N3O2 and a molecular weight of 305.28 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-difluorophenyl)ethylideneamino]-2-(2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-[(Z)-1-(2,4-difluorophenyl)ethylideneamino]-2-(2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 8884138 |
| Molecular Formula | C15H13F2N3O2 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[(Z)-1-(2,4-difluorophenyl)ethylideneamino]-2-(2-oxo-1-pyridinyl)acetamide |
| SMILES | C/C(=N/NC(=O)Cn1ccccc1=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H13F2N3O2/c1-10(12-6-5-11(16)8-13(12)17)18-19-14(21)9-20-7-3-2-4-15(20)22/h2-8H,9H2,1H3,(H,19,21)/b18-10- |
| InChIKey | CHIBRYGBPVCBGV-ZDLGFXPLSA-N |
| XLogP | 1.67 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|