About (5Z)-3H-4,1-benzoxazocine
(5Z)-3H-4,1-benzoxazocine (PubChem CID 88841509) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is (5Z)-3H-4,1-benzoxazocine.
Molecular Properties
| Compound Name | (5Z)-3H-4,1-benzoxazocine |
| PubChem CID | 88841509 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | (5Z)-3H-4,1-benzoxazocine |
| SMILES | C1=C\c2ccccc2/N=C\CO/1 |
| InChI | InChI=1S/C10H9NO/c1-2-4-10-9(3-1)5-7-12-8-6-11-10/h1-7H,8H2/b7-5-,11-6- |
| InChIKey | HHDZPYDYAHWNKQ-JMPJYAQRSA-N |
| XLogP | 2.39 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z)-3H-4,1-benzoxazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-3H-4,1-benzoxazocine?
The IUPAC name of (5Z)-3H-4,1-benzoxazocine (CID 88841509) is (5Z)-3H-4,1-benzoxazocine.
What is the SMILES notation for (5Z)-3H-4,1-benzoxazocine?
The canonical SMILES for (5Z)-3H-4,1-benzoxazocine is C1=C\c2ccccc2/N=C\CO/1.
What is the InChIKey of (5Z)-3H-4,1-benzoxazocine?
The InChIKey is HHDZPYDYAHWNKQ-JMPJYAQRSA-N. The full InChI is InChI=1S/C10H9NO/c1-2-4-10-9(3-1)5-7-12-8-6-11-10/h1-7H,8H2/b7-5-,11-6-.
What are the key properties of (5Z)-3H-4,1-benzoxazocine?
(5Z)-3H-4,1-benzoxazocine has a molecular weight of 159.19 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-3H-4,1-benzoxazocine is sourced from PubChem (CID 88841509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).