About sulfanyl 2-methylpropanedithioate
sulfanyl 2-methylpropanedithioate (PubChem CID 88841968) has the molecular formula C4H8S3
and a molecular weight of 152.31 g/mol. Its IUPAC name is sulfanyl 2-methylpropanedithioate.
Molecular Properties
| Compound Name | sulfanyl 2-methylpropanedithioate |
| PubChem CID | 88841968 |
| Molecular Formula | C4H8S3 |
| Molecular Weight | 152.31 g/mol |
| Exact Mass | 151.98 |
| IUPAC Name | sulfanyl 2-methylpropanedithioate |
| SMILES | CC(C)C(=S)SS |
| InChI | InChI=1S/C4H8S3/c1-3(2)4(5)7-6/h3,6H,1-2H3 |
| InChIKey | WSZQOCMVGJIUDA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl 2-methylpropanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl 2-methylpropanedithioate?
The IUPAC name of sulfanyl 2-methylpropanedithioate (CID 88841968) is sulfanyl 2-methylpropanedithioate.
What is the SMILES notation for sulfanyl 2-methylpropanedithioate?
The canonical SMILES for sulfanyl 2-methylpropanedithioate is CC(C)C(=S)SS.
What is the InChIKey of sulfanyl 2-methylpropanedithioate?
The InChIKey is WSZQOCMVGJIUDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8S3/c1-3(2)4(5)7-6/h3,6H,1-2H3.
What are the key properties of sulfanyl 2-methylpropanedithioate?
sulfanyl 2-methylpropanedithioate has a molecular weight of 152.31 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl 2-methylpropanedithioate is sourced from PubChem (CID 88841968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).