About [(2,4-dichlorophenyl)disulfanyl]carbamic acid
[(2,4-dichlorophenyl)disulfanyl]carbamic acid (PubChem CID 88842304) has the molecular formula C7H5Cl2NO2S2
and a molecular weight of 270.16 g/mol. Its IUPAC name is [(2,4-dichlorophenyl)disulfanyl]carbamic acid.
Molecular Properties
| Compound Name | [(2,4-dichlorophenyl)disulfanyl]carbamic acid |
| PubChem CID | 88842304 |
| Molecular Formula | C7H5Cl2NO2S2 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 268.91 |
| IUPAC Name | [(2,4-dichlorophenyl)disulfanyl]carbamic acid |
| SMILES | O=C(O)NSSc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl2NO2S2/c8-4-1-2-6(5(9)3-4)13-14-10-7(11)12/h1-3,10H,(H,11,12) |
| InChIKey | MMVISRSTAAKKPI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2,4-dichlorophenyl)disulfanyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,4-dichlorophenyl)disulfanyl]carbamic acid?
The IUPAC name of [(2,4-dichlorophenyl)disulfanyl]carbamic acid (CID 88842304) is [(2,4-dichlorophenyl)disulfanyl]carbamic acid.
What is the SMILES notation for [(2,4-dichlorophenyl)disulfanyl]carbamic acid?
The canonical SMILES for [(2,4-dichlorophenyl)disulfanyl]carbamic acid is O=C(O)NSSc1ccc(Cl)cc1Cl.
What is the InChIKey of [(2,4-dichlorophenyl)disulfanyl]carbamic acid?
The InChIKey is MMVISRSTAAKKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2NO2S2/c8-4-1-2-6(5(9)3-4)13-14-10-7(11)12/h1-3,10H,(H,11,12).
What are the key properties of [(2,4-dichlorophenyl)disulfanyl]carbamic acid?
[(2,4-dichlorophenyl)disulfanyl]carbamic acid has a molecular weight of 270.16 g/mol, XLogP of 3.92, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,4-dichlorophenyl)disulfanyl]carbamic acid is sourced from PubChem (CID 88842304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).