About 2-isocyanatobenzene-1,3-diol
2-isocyanatobenzene-1,3-diol (PubChem CID 88843345) has the molecular formula C7H5NO3
and a molecular weight of 151.12 g/mol. Its IUPAC name is 2-isocyanatobenzene-1,3-diol.
Molecular Properties
| Compound Name | 2-isocyanatobenzene-1,3-diol |
| PubChem CID | 88843345 |
| Molecular Formula | C7H5NO3 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 2-isocyanatobenzene-1,3-diol |
| SMILES | O=C=Nc1c(O)cccc1O |
| InChI | InChI=1S/C7H5NO3/c9-4-8-7-5(10)2-1-3-6(7)11/h1-3,10-11H |
| InChIKey | WZQTWCGJPNHAMS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanatobenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanatobenzene-1,3-diol?
The IUPAC name of 2-isocyanatobenzene-1,3-diol (CID 88843345) is 2-isocyanatobenzene-1,3-diol.
What is the SMILES notation for 2-isocyanatobenzene-1,3-diol?
The canonical SMILES for 2-isocyanatobenzene-1,3-diol is O=C=Nc1c(O)cccc1O.
What is the InChIKey of 2-isocyanatobenzene-1,3-diol?
The InChIKey is WZQTWCGJPNHAMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3/c9-4-8-7-5(10)2-1-3-6(7)11/h1-3,10-11H.
What are the key properties of 2-isocyanatobenzene-1,3-diol?
2-isocyanatobenzene-1,3-diol has a molecular weight of 151.12 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanatobenzene-1,3-diol is sourced from PubChem (CID 88843345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).