About N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide
N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide (PubChem CID 88843779) has the molecular formula C12H16N2S2
and a molecular weight of 252.41 g/mol. Its IUPAC name is N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide |
| PubChem CID | 88843779 |
| Molecular Formula | C12H16N2S2 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide |
| SMILES | CCCCC1=CC(=S)C=C(N/C=N/C)C1=S |
| InChI | InChI=1S/C12H16N2S2/c1-3-4-5-9-6-10(15)7-11(12(9)16)14-8-13-2/h6-8H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | LSWVFMJXCZAPOA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide?
The IUPAC name of N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide (CID 88843779) is N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide?
The canonical SMILES for N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide is CCCCC1=CC(=S)C=C(N/C=N/C)C1=S.
What is the InChIKey of N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide?
The InChIKey is LSWVFMJXCZAPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2S2/c1-3-4-5-9-6-10(15)7-11(12(9)16)14-8-13-2/h6-8H,3-5H2,1-2H3,(H,13,14).
What are the key properties of N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide?
N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide has a molecular weight of 252.41 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-butyl-3,6-bis(sulfanylidene)cyclohexa-1,4-dien-1-yl]-N'-methylmethanimidamide is sourced from PubChem (CID 88843779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).