About 2,2,2-trinitroethanamine
2,2,2-trinitroethanamine (PubChem CID 88843803) has the molecular formula C2H4N4O6
and a molecular weight of 180.08 g/mol. Its IUPAC name is 2,2,2-trinitroethanamine.
Molecular Properties
| Compound Name | 2,2,2-trinitroethanamine |
| PubChem CID | 88843803 |
| Molecular Formula | C2H4N4O6 |
| Molecular Weight | 180.08 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 2,2,2-trinitroethanamine |
| SMILES | NCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C2H4N4O6/c3-1-2(4(7)8,5(9)10)6(11)12/h1,3H2 |
| InChIKey | GTBUJZUROLUQPM-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 155.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.08 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trinitroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trinitroethanamine?
The IUPAC name of 2,2,2-trinitroethanamine (CID 88843803) is 2,2,2-trinitroethanamine.
What is the SMILES notation for 2,2,2-trinitroethanamine?
The canonical SMILES for 2,2,2-trinitroethanamine is NCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2,2,2-trinitroethanamine?
The InChIKey is GTBUJZUROLUQPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N4O6/c3-1-2(4(7)8,5(9)10)6(11)12/h1,3H2.
What are the key properties of 2,2,2-trinitroethanamine?
2,2,2-trinitroethanamine has a molecular weight of 180.08 g/mol, XLogP of -1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trinitroethanamine is sourced from PubChem (CID 88843803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).