C19H34O6 — CID 88844498
6-[(1S,2S,3S,5R)-2-(3-hydroperoxyoct-1-enyl)-3,5-dihydroxycyclopentyl]hexanoic acid (PubChem CID 88844498) has the molecular formula C19H34O6 and a molecular weight of 358.48 g/mol. Its IUPAC name is 6-[(1S,2S,3S,5R)-2-(3-hydroperoxyoct-1-enyl)-3,5-dihydroxycyclopentyl]hexanoic acid.
| Compound Name | 6-[(1S,2S,3S,5R)-2-(3-hydroperoxyoct-1-enyl)-3,5-dihydroxycyclopentyl]hexanoic acid |
|---|---|
| PubChem CID | 88844498 |
| Molecular Formula | C19H34O6 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 6-[(1S,2S,3S,5R)-2-(3-hydroperoxyoct-1-enyl)-3,5-dihydroxycyclopentyl]hexanoic acid |
| SMILES | CCCCCC(C=C[C@H]1[C@H](CCCCCC(=O)O)[C@H](O)C[C@@H]1O)OO |
| InChI | InChI=1S/C19H34O6/c1-2-3-5-8-14(25-24)11-12-16-15(17(20)13-18(16)21)9-6-4-7-10-19(22)23/h11-12,14-18,20-21,24H,2-10,13H2,1H3,(H,22,23)/t14?,15-,16-,17+,18-/m0/s1 |
| InChIKey | DKTBFUUYQUCJJY-GPQQEZGISA-N |
| XLogP | 3.37 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|