C11H18O3 — CID 88844707
(2E,4E)-6,6-diethoxy-3-methylhexa-2,4-dienal (PubChem CID 88844707) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (2E,4E)-6,6-diethoxy-3-methylhexa-2,4-dienal.
| Compound Name | (2E,4E)-6,6-diethoxy-3-methylhexa-2,4-dienal |
|---|---|
| PubChem CID | 88844707 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (2E,4E)-6,6-diethoxy-3-methylhexa-2,4-dienal |
| SMILES | CCOC(/C=C/C(C)=C/C=O)OCC |
| InChI | InChI=1S/C11H18O3/c1-4-13-11(14-5-2)7-6-10(3)8-9-12/h6-9,11H,4-5H2,1-3H3/b7-6+,10-8+ |
| InChIKey | ITUAKMVDTGLSRK-LQPGMRSMSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|