C13H19NO2 — CID 88844740
2-[[2-(aziridin-1-yl)phenyl]methyl]butane-1,3-diol (PubChem CID 88844740) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[[2-(aziridin-1-yl)phenyl]methyl]butane-1,3-diol.
| Compound Name | 2-[[2-(aziridin-1-yl)phenyl]methyl]butane-1,3-diol |
|---|---|
| PubChem CID | 88844740 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-[[2-(aziridin-1-yl)phenyl]methyl]butane-1,3-diol |
| SMILES | CC(O)C(CO)Cc1ccccc1N1CC1 |
| InChI | InChI=1S/C13H19NO2/c1-10(16)12(9-15)8-11-4-2-3-5-13(11)14-6-7-14/h2-5,10,12,15-16H,6-9H2,1H3 |
| InChIKey | DMTFISICWIHDBS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 43.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|