C30H50O6 — CID 88845617
(1S,2R,3R)-2-[7-hydroxy-7,7-bis(oxan-2-yloxy)hepta-2,3-dienyl]-3-oct-1-enylcyclopentan-1-ol (PubChem CID 88845617) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is (1S,2R,3R)-2-[7-hydroxy-7,7-bis(oxan-2-yloxy)hepta-2,3-dienyl]-3-oct-1-enylcyclopentan-1-ol.
| Compound Name | (1S,2R,3R)-2-[7-hydroxy-7,7-bis(oxan-2-yloxy)hepta-2,3-dienyl]-3-oct-1-enylcyclopentan-1-ol |
|---|---|
| PubChem CID | 88845617 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | (1S,2R,3R)-2-[7-hydroxy-7,7-bis(oxan-2-yloxy)hepta-2,3-dienyl]-3-oct-1-enylcyclopentan-1-ol |
| SMILES | CCCCCCC=C[C@H]1CC[C@H](O)[C@@H]1CC=C=CCCC(O)(OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C30H50O6/c1-2-3-4-5-6-9-16-25-20-21-27(31)26(25)17-10-7-8-13-22-30(32,35-28-18-11-14-23-33-28)36-29-19-12-15-24-34-29/h8-10,16,25-29,31-32H,2-6,11-15,17-24H2,1H3/t7?,25-,26+,27-,28?,29?,30?/m0/s1 |
| InChIKey | LHNFLKVWRLMQHK-XRMOQMGVSA-N |
| XLogP | 6.51 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|