About [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone
[4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone (PubChem CID 88845639) has the molecular formula C18H18O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone |
| PubChem CID | 88845639 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone |
| SMILES | CC1(C)OC1COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18O3/c1-18(2)16(21-18)12-20-15-10-8-14(9-11-15)17(19)13-6-4-3-5-7-13/h3-11,16H,12H2,1-2H3 |
| InChIKey | ZVUJKGIVIWXIBH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone?
The IUPAC name of [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone (CID 88845639) is [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone.
What is the SMILES notation for [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone?
The canonical SMILES for [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone is CC1(C)OC1COc1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone?
The InChIKey is ZVUJKGIVIWXIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3/c1-18(2)16(21-18)12-20-15-10-8-14(9-11-15)17(19)13-6-4-3-5-7-13/h3-11,16H,12H2,1-2H3.
What are the key properties of [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone?
[4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone has a molecular weight of 282.34 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3,3-dimethyloxiran-2-yl)methoxy]phenyl]-phenylmethanone is sourced from PubChem (CID 88845639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).