C17H15NO — CID 88845755
N-(8-tricyclo[9.4.0.02,7]pentadeca-1,3,5,8,10,12,14-heptaenylmethyl)formamide (PubChem CID 88845755) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is N-(8-tricyclo[9.4.0.02,7]pentadeca-1,3,5,8,10,12,14-heptaenylmethyl)formamide.
| Compound Name | N-(8-tricyclo[9.4.0.02,7]pentadeca-1,3,5,8,10,12,14-heptaenylmethyl)formamide |
|---|---|
| PubChem CID | 88845755 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-(8-tricyclo[9.4.0.02,7]pentadeca-1,3,5,8,10,12,14-heptaenylmethyl)formamide |
| SMILES | O=CNCC1=CC=c2ccccc2=C2C=CC=CC12 |
| InChI | InChI=1S/C17H15NO/c19-12-18-11-14-10-9-13-5-1-2-6-15(13)17-8-4-3-7-16(14)17/h1-10,12,16H,11H2,(H,18,19) |
| InChIKey | NSTDRIHBYYGELA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|