C24H50O4 — CID 88845871
2-tert-butylperoxy-2-methylpropane;3-(5-ethyl-2,2,3,5,6,6-hexamethylheptan-3-yl)dioxirane (PubChem CID 88845871) has the molecular formula C24H50O4 and a molecular weight of 402.66 g/mol. Its IUPAC name is 2-tert-butylperoxy-2-methylpropane;3-(5-ethyl-2,2,3,5,6,6-hexamethylheptan-3-yl)dioxirane.
| Compound Name | 2-tert-butylperoxy-2-methylpropane;3-(5-ethyl-2,2,3,5,6,6-hexamethylheptan-3-yl)dioxirane |
|---|---|
| PubChem CID | 88845871 |
| Molecular Formula | C24H50O4 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | 2-tert-butylperoxy-2-methylpropane;3-(5-ethyl-2,2,3,5,6,6-hexamethylheptan-3-yl)dioxirane |
| SMILES | CC(C)(C)OOC(C)(C)C.CCC(C)(CC(C)(C1OO1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H32O2.C8H18O2/c1-10-15(8,13(2,3)4)11-16(9,12-17-18-12)14(5,6)7;1-7(2,3)9-10-8(4,5)6/h12H,10-11H2,1-9H3;1-6H3 |
| InChIKey | DSBCDPPFEXHKJN-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|