About 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine
3-oxido-2-(phenoxymethyl)-1,3-oxazolidine (PubChem CID 88846118) has the molecular formula C10H12NO3-
and a molecular weight of 194.21 g/mol. Its IUPAC name is 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine |
| PubChem CID | 88846118 |
| Molecular Formula | C10H12NO3- |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine |
| SMILES | [O-]N1CCOC1COc1ccccc1 |
| InChI | InChI=1S/C10H12NO3/c12-11-6-7-13-10(11)8-14-9-4-2-1-3-5-9/h1-5,10H,6-8H2/q-1 |
| InChIKey | ONFBXWPDDQXXRL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine?
The IUPAC name of 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine (CID 88846118) is 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine.
What is the SMILES notation for 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine?
The canonical SMILES for 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine is [O-]N1CCOC1COc1ccccc1.
What is the InChIKey of 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine?
The InChIKey is ONFBXWPDDQXXRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12NO3/c12-11-6-7-13-10(11)8-14-9-4-2-1-3-5-9/h1-5,10H,6-8H2/q-1.
What are the key properties of 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine?
3-oxido-2-(phenoxymethyl)-1,3-oxazolidine has a molecular weight of 194.21 g/mol, XLogP of 1.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxido-2-(phenoxymethyl)-1,3-oxazolidine is sourced from PubChem (CID 88846118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).