About hept-6-ene-1,6-diamine
hept-6-ene-1,6-diamine (PubChem CID 88846355) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is hept-6-ene-1,6-diamine.
Molecular Properties
| Compound Name | hept-6-ene-1,6-diamine |
| PubChem CID | 88846355 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | hept-6-ene-1,6-diamine |
| SMILES | C=C(N)CCCCCN |
| InChI | InChI=1S/C7H16N2/c1-7(9)5-3-2-4-6-8/h1-6,8-9H2 |
| InChIKey | DNGVEJZHWVGUML-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hept-6-ene-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-ene-1,6-diamine?
The IUPAC name of hept-6-ene-1,6-diamine (CID 88846355) is hept-6-ene-1,6-diamine.
What is the SMILES notation for hept-6-ene-1,6-diamine?
The canonical SMILES for hept-6-ene-1,6-diamine is C=C(N)CCCCCN.
What is the InChIKey of hept-6-ene-1,6-diamine?
The InChIKey is DNGVEJZHWVGUML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2/c1-7(9)5-3-2-4-6-8/h1-6,8-9H2.
What are the key properties of hept-6-ene-1,6-diamine?
hept-6-ene-1,6-diamine has a molecular weight of 128.22 g/mol, XLogP of 0.98, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-ene-1,6-diamine is sourced from PubChem (CID 88846355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).