C15H23NO5 — CID 88846581
1-methyl-3-[propoxy(propyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 88846581) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-methyl-3-[propoxy(propyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 1-methyl-3-[propoxy(propyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88846581 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-methyl-3-[propoxy(propyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCCON(CCC)C(=O)C1C2C=CC(C)(O2)C1C(=O)O |
| InChI | InChI=1S/C15H23NO5/c1-4-8-16(20-9-5-2)13(17)11-10-6-7-15(3,21-10)12(11)14(18)19/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,18,19) |
| InChIKey | UXHQULRTBOEUIL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|