About dioxido(oxo)titanium;bis(triethylazanium)
dioxido(oxo)titanium;bis(triethylazanium) (PubChem CID 88846724) has the molecular formula C12H32N2O3Ti
and a molecular weight of 300.27 g/mol. Its IUPAC name is dioxido(oxo)titanium;bis(triethylazanium).
Molecular Properties
| Compound Name | dioxido(oxo)titanium;bis(triethylazanium) |
| PubChem CID | 88846724 |
| Molecular Formula | C12H32N2O3Ti |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | dioxido(oxo)titanium;bis(triethylazanium) |
| SMILES | CC[NH+](CC)CC.CC[NH+](CC)CC.O=[Ti]([O-])[O-] |
| InChI | InChI=1S/2C6H15N.3O.Ti/c2*1-4-7(5-2)6-3;;;;/h2*4-6H2,1-3H3;;;;/q;;;2*-1;/p+2 |
| InChIKey | QBICYRHWZCYKNJ-UHFFFAOYSA-P |
| XLogP | -2.64 |
| TPSA | 72.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dioxido(oxo)titanium;bis(triethylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)titanium;bis(triethylazanium)?
The IUPAC name of dioxido(oxo)titanium;bis(triethylazanium) (CID 88846724) is dioxido(oxo)titanium;bis(triethylazanium).
What is the SMILES notation for dioxido(oxo)titanium;bis(triethylazanium)?
The canonical SMILES for dioxido(oxo)titanium;bis(triethylazanium) is CC[NH+](CC)CC.CC[NH+](CC)CC.O=[Ti]([O-])[O-].
What is the InChIKey of dioxido(oxo)titanium;bis(triethylazanium)?
The InChIKey is QBICYRHWZCYKNJ-UHFFFAOYSA-P. The full InChI is InChI=1S/2C6H15N.3O.Ti/c2*1-4-7(5-2)6-3;;;;/h2*4-6H2,1-3H3;;;;/q;;;2*-1;/p+2.
What are the key properties of dioxido(oxo)titanium;bis(triethylazanium)?
dioxido(oxo)titanium;bis(triethylazanium) has a molecular weight of 300.27 g/mol, XLogP of -2.64, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)titanium;bis(triethylazanium) is sourced from PubChem (CID 88846724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).