About 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide
2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide (PubChem CID 88846967) has the molecular formula C14H19ClN2O2
and a molecular weight of 282.77 g/mol. Its IUPAC name is 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide |
| PubChem CID | 88846967 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide |
| SMILES | C=NOCN(C(=O)CCl)c1c(C)ccc(CC)c1C |
| InChI | InChI=1S/C14H19ClN2O2/c1-5-12-7-6-10(2)14(11(12)3)17(9-19-16-4)13(18)8-15/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | XVKRJESCQAZBPS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide?
The IUPAC name of 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide (CID 88846967) is 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide.
What is the SMILES notation for 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide?
The canonical SMILES for 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide is C=NOCN(C(=O)CCl)c1c(C)ccc(CC)c1C.
What is the InChIKey of 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide?
The InChIKey is XVKRJESCQAZBPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN2O2/c1-5-12-7-6-10(2)14(11(12)3)17(9-19-16-4)13(18)8-15/h6-7H,4-5,8-9H2,1-3H3.
What are the key properties of 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide?
2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide has a molecular weight of 282.77 g/mol, XLogP of 3.03, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3-ethyl-2,6-dimethylphenyl)-N-[(methylideneamino)oxymethyl]acetamide is sourced from PubChem (CID 88846967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).