About 3-amino-1-pentoxypropan-1-ol;pentan-1-amine
3-amino-1-pentoxypropan-1-ol;pentan-1-amine (PubChem CID 88847262) has the molecular formula C13H32N2O2
and a molecular weight of 248.41 g/mol. Its IUPAC name is 3-amino-1-pentoxypropan-1-ol;pentan-1-amine.
Molecular Properties
| Compound Name | 3-amino-1-pentoxypropan-1-ol;pentan-1-amine |
| PubChem CID | 88847262 |
| Molecular Formula | C13H32N2O2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 3-amino-1-pentoxypropan-1-ol;pentan-1-amine |
| SMILES | CCCCCN.CCCCCOC(O)CCN |
| InChI | InChI=1S/C8H19NO2.C5H13N/c1-2-3-4-7-11-8(10)5-6-9;1-2-3-4-5-6/h8,10H,2-7,9H2,1H3;2-6H2,1H3 |
| InChIKey | MGEAWDVVOPFXTR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-pentoxypropan-1-ol;pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-pentoxypropan-1-ol;pentan-1-amine?
The IUPAC name of 3-amino-1-pentoxypropan-1-ol;pentan-1-amine (CID 88847262) is 3-amino-1-pentoxypropan-1-ol;pentan-1-amine.
What is the SMILES notation for 3-amino-1-pentoxypropan-1-ol;pentan-1-amine?
The canonical SMILES for 3-amino-1-pentoxypropan-1-ol;pentan-1-amine is CCCCCN.CCCCCOC(O)CCN.
What is the InChIKey of 3-amino-1-pentoxypropan-1-ol;pentan-1-amine?
The InChIKey is MGEAWDVVOPFXTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2.C5H13N/c1-2-3-4-7-11-8(10)5-6-9;1-2-3-4-5-6/h8,10H,2-7,9H2,1H3;2-6H2,1H3.
What are the key properties of 3-amino-1-pentoxypropan-1-ol;pentan-1-amine?
3-amino-1-pentoxypropan-1-ol;pentan-1-amine has a molecular weight of 248.41 g/mol, XLogP of 2.00, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-pentoxypropan-1-ol;pentan-1-amine is sourced from PubChem (CID 88847262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).