C17H19N — CID 88847452
1-azatetracyclo[8.7.1.02,7.014,18]octadeca-2,7,9,11,13-pentaene (PubChem CID 88847452) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-azatetracyclo[8.7.1.02,7.014,18]octadeca-2,7,9,11,13-pentaene.
| Compound Name | 1-azatetracyclo[8.7.1.02,7.014,18]octadeca-2,7,9,11,13-pentaene |
|---|---|
| PubChem CID | 88847452 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-azatetracyclo[8.7.1.02,7.014,18]octadeca-2,7,9,11,13-pentaene |
| SMILES | C1=CC2=CC=C3CCCC=C3N3CCCC(=C1)C23 |
| InChI | InChI=1S/C17H19N/c1-2-9-16-13(5-1)10-11-15-7-3-6-14-8-4-12-18(16)17(14)15/h3,6-7,9-11,17H,1-2,4-5,8,12H2 |
| InChIKey | OCIPQYGJFNTFFQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |