C14H8Cl6O3 — CID 88847512
1,2,3-trichloro-4-[(2,3,4-trichlorophenoxy)methoxymethoxy]benzene (PubChem CID 88847512) has the molecular formula C14H8Cl6O3 and a molecular weight of 436.93 g/mol. Its IUPAC name is 1,2,3-trichloro-4-[(2,3,4-trichlorophenoxy)methoxymethoxy]benzene.
| Compound Name | 1,2,3-trichloro-4-[(2,3,4-trichlorophenoxy)methoxymethoxy]benzene |
|---|---|
| PubChem CID | 88847512 |
| Molecular Formula | C14H8Cl6O3 |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 433.86 |
| IUPAC Name | 1,2,3-trichloro-4-[(2,3,4-trichlorophenoxy)methoxymethoxy]benzene |
| SMILES | Clc1ccc(OCOCOc2ccc(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H8Cl6O3/c15-7-1-3-9(13(19)11(7)17)22-5-21-6-23-10-4-2-8(16)12(18)14(10)20/h1-4H,5-6H2 |
| InChIKey | FNRSCLLYKWBYGQ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|