About 3-oxido-1,3-oxazolidin-3-ium-5-one
3-oxido-1,3-oxazolidin-3-ium-5-one (PubChem CID 88847729) has the molecular formula C3H5NO3
and a molecular weight of 103.08 g/mol. Its IUPAC name is 3-oxido-1,3-oxazolidin-3-ium-5-one.
Molecular Properties
| Compound Name | 3-oxido-1,3-oxazolidin-3-ium-5-one |
| PubChem CID | 88847729 |
| Molecular Formula | C3H5NO3 |
| Molecular Weight | 103.08 g/mol |
| Exact Mass | 103.03 |
| IUPAC Name | 3-oxido-1,3-oxazolidin-3-ium-5-one |
| SMILES | O=C1C[NH+]([O-])CO1 |
| InChI | InChI=1S/C3H5NO3/c5-3-1-4(6)2-7-3/h4H,1-2H2 |
| InChIKey | PNYRIWKOPHNLDC-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 53.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.08 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-oxido-1,3-oxazolidin-3-ium-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxido-1,3-oxazolidin-3-ium-5-one?
The IUPAC name of 3-oxido-1,3-oxazolidin-3-ium-5-one (CID 88847729) is 3-oxido-1,3-oxazolidin-3-ium-5-one.
What is the SMILES notation for 3-oxido-1,3-oxazolidin-3-ium-5-one?
The canonical SMILES for 3-oxido-1,3-oxazolidin-3-ium-5-one is O=C1C[NH+]([O-])CO1.
What is the InChIKey of 3-oxido-1,3-oxazolidin-3-ium-5-one?
The InChIKey is PNYRIWKOPHNLDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO3/c5-3-1-4(6)2-7-3/h4H,1-2H2.
What are the key properties of 3-oxido-1,3-oxazolidin-3-ium-5-one?
3-oxido-1,3-oxazolidin-3-ium-5-one has a molecular weight of 103.08 g/mol, XLogP of -2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxido-1,3-oxazolidin-3-ium-5-one is sourced from PubChem (CID 88847729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).