C8H2F3N3O4 — CID 88847883
4-(difluoromethyl)-3-fluoro-2,6-dinitrobenzonitrile (PubChem CID 88847883) has the molecular formula C8H2F3N3O4 and a molecular weight of 261.12 g/mol. Its IUPAC name is 4-(difluoromethyl)-3-fluoro-2,6-dinitrobenzonitrile.
| Compound Name | 4-(difluoromethyl)-3-fluoro-2,6-dinitrobenzonitrile |
|---|---|
| PubChem CID | 88847883 |
| Molecular Formula | C8H2F3N3O4 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 4-(difluoromethyl)-3-fluoro-2,6-dinitrobenzonitrile |
| SMILES | N#Cc1c([N+](=O)[O-])cc(C(F)F)c(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H2F3N3O4/c9-6-3(8(10)11)1-5(13(15)16)4(2-12)7(6)14(17)18/h1,8H |
| InChIKey | PYZPRCHTSUYNFU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|