C7H7F6N3O6 — CID 88847905
[1-(difluoroamino)-5-fluoro-5,5-dinitropentyl] 2,2,2-trifluoroacetate (PubChem CID 88847905) has the molecular formula C7H7F6N3O6 and a molecular weight of 343.14 g/mol. Its IUPAC name is [1-(difluoroamino)-5-fluoro-5,5-dinitropentyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-(difluoroamino)-5-fluoro-5,5-dinitropentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 88847905 |
| Molecular Formula | C7H7F6N3O6 |
| Molecular Weight | 343.14 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | [1-(difluoroamino)-5-fluoro-5,5-dinitropentyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(CCCC(F)([N+](=O)[O-])[N+](=O)[O-])N(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H7F6N3O6/c8-6(15(18)19,16(20)21)3-1-2-4(14(12)13)22-5(17)7(9,10)11/h4H,1-3H2 |
| InChIKey | LYHWCDSUINEKSA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|