C29H51N7O7S — CID 88848805
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[5-[4-oxo-4-(oxolan-2-ylmethylamino)butyl]-1,2-dihydrotriazol-3-yl]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 88848805) has the molecular formula C29H51N7O7S and a molecular weight of 641.84 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[5-[4-oxo-4-(oxolan-2-ylmethylamino)butyl]-1,2-dihydrotriazol-3-yl]ethoxy]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[5-[4-oxo-4-(oxolan-2-ylmethylamino)butyl]-1,2-dihydrotriazol-3-yl]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 88848805 |
| Molecular Formula | C29H51N7O7S |
| Molecular Weight | 641.84 g/mol |
| Exact Mass | 641.36 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[5-[4-oxo-4-(oxolan-2-ylmethylamino)butyl]-1,2-dihydrotriazol-3-yl]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCOCCOCCOCCN1C=C(CCCC(=O)NCC2CCCO2)NN1 |
| InChI | InChI=1S/C29H51N7O7S/c37-26(8-2-1-7-25-28-24(21-44-25)32-29(39)33-28)30-10-13-40-15-17-42-18-16-41-14-11-36-20-22(34-35-36)5-3-9-27(38)31-19-23-6-4-12-43-23/h20,23-25,28,34-35H,1-19,21H2,(H,30,37)(H,31,38)(H2,32,33,39) |
| InChIKey | JRNQVUZUBMCLBG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 163.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.84 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|