C10H20N2 — CID 88848988
(Z)-4-imino-N,N,3,5-tetramethylhex-2-en-2-amine (PubChem CID 88848988) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (Z)-4-imino-N,N,3,5-tetramethylhex-2-en-2-amine.
| Compound Name | (Z)-4-imino-N,N,3,5-tetramethylhex-2-en-2-amine |
|---|---|
| PubChem CID | 88848988 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (Z)-4-imino-N,N,3,5-tetramethylhex-2-en-2-amine |
| SMILES | [H]/N=C(C(/C)=C(/C)N(C)C)\C(C)C |
| InChI | InChI=1S/C10H20N2/c1-7(2)10(11)8(3)9(4)12(5)6/h7,11H,1-6H3/b9-8-,11-10+ |
| InChIKey | BYZCQOYWJINPOL-QNRZBPGKSA-N |
| XLogP | 2.52 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|