C12H19NOS — CID 88849022
1-but-3-ynyl-N-(2-methylsulfanylethyl)cyclobutane-1-carboxamide (PubChem CID 88849022) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 1-but-3-ynyl-N-(2-methylsulfanylethyl)cyclobutane-1-carboxamide.
| Compound Name | 1-but-3-ynyl-N-(2-methylsulfanylethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 88849022 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1-but-3-ynyl-N-(2-methylsulfanylethyl)cyclobutane-1-carboxamide |
| SMILES | C#CCCC1(C(=O)NCCSC)CCC1 |
| InChI | InChI=1S/C12H19NOS/c1-3-4-6-12(7-5-8-12)11(14)13-9-10-15-2/h1H,4-10H2,2H3,(H,13,14) |
| InChIKey | QPZFMSUACRRNEZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|