C13H24O4S — CID 88849466
butan-2-yl 2-[(4R,6S)-2,2-dimethyl-6-(sulfanylmethyl)-1,3-dioxan-4-yl]acetate (PubChem CID 88849466) has the molecular formula C13H24O4S and a molecular weight of 276.40 g/mol. Its IUPAC name is butan-2-yl 2-[(4R,6S)-2,2-dimethyl-6-(sulfanylmethyl)-1,3-dioxan-4-yl]acetate.
| Compound Name | butan-2-yl 2-[(4R,6S)-2,2-dimethyl-6-(sulfanylmethyl)-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 88849466 |
| Molecular Formula | C13H24O4S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | butan-2-yl 2-[(4R,6S)-2,2-dimethyl-6-(sulfanylmethyl)-1,3-dioxan-4-yl]acetate |
| SMILES | CCC(C)OC(=O)C[C@H]1C[C@@H](CS)OC(C)(C)O1 |
| InChI | InChI=1S/C13H24O4S/c1-5-9(2)15-12(14)7-10-6-11(8-18)17-13(3,4)16-10/h9-11,18H,5-8H2,1-4H3/t9?,10-,11+/m1/s1 |
| InChIKey | ISTDGAOHWSAZQJ-ZOCYIJKUSA-N |
| XLogP | 2.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|