C23H22ClN3O3 — CID 88849505
4-[[2-[2-[(2-chlorophenyl)methylamino]phenyl]-1-oxopropan-2-yl]amino]-N-hydroxybenzamide (PubChem CID 88849505) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is 4-[[2-[2-[(2-chlorophenyl)methylamino]phenyl]-1-oxopropan-2-yl]amino]-N-hydroxybenzamide.
| Compound Name | 4-[[2-[2-[(2-chlorophenyl)methylamino]phenyl]-1-oxopropan-2-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 88849505 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 4-[[2-[2-[(2-chlorophenyl)methylamino]phenyl]-1-oxopropan-2-yl]amino]-N-hydroxybenzamide |
| SMILES | CC(C=O)(Nc1ccc(C(=O)NO)cc1)c1ccccc1NCc1ccccc1Cl |
| InChI | InChI=1S/C23H22ClN3O3/c1-23(15-28,26-18-12-10-16(11-13-18)22(29)27-30)19-7-3-5-9-21(19)25-14-17-6-2-4-8-20(17)24/h2-13,15,25-26,30H,14H2,1H3,(H,27,29) |
| InChIKey | JNUFOMHJKLROOY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|