C33H33F5O4S — CID 88849730
(11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(3-methylsulfonylphenyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88849730) has the molecular formula C33H33F5O4S and a molecular weight of 620.68 g/mol. Its IUPAC name is (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(3-methylsulfonylphenyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(3-methylsulfonylphenyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88849730 |
| Molecular Formula | C33H33F5O4S |
| Molecular Weight | 620.68 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(3-methylsulfonylphenyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](c3ccc(-c4cccc(S(C)(=O)=O)c4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H33F5O4S/c1-30-18-27(20-8-6-19(7-9-20)21-4-3-5-24(17-21)43(2,41)42)29-25-13-11-23(39)16-22(25)10-12-26(29)28(30)14-15-31(30,40)32(34,35)33(36,37)38/h3-9,16-17,26-28,40H,10-15,18H2,1-2H3/t26?,27-,28?,30+,31+/m1/s1 |
| InChIKey | VPGKBAPLZRCOMT-MUDKOERHSA-N |
| XLogP | 7.59 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.68 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|