C18H16ClF4N3O4 — CID 88850176
3-(2-chloro-6-fluorophenyl)-5-[(Z)-1-(dimethylamino)-4,4,4-trifluoro-3-oxobut-1-en-2-yl]-N-methoxy-N-methyl-1,2-oxazole-4-carboxamide (PubChem CID 88850176) has the molecular formula C18H16ClF4N3O4 and a molecular weight of 449.79 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-5-[(Z)-1-(dimethylamino)-4,4,4-trifluoro-3-oxobut-1-en-2-yl]-N-methoxy-N-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-5-[(Z)-1-(dimethylamino)-4,4,4-trifluoro-3-oxobut-1-en-2-yl]-N-methoxy-N-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 88850176 |
| Molecular Formula | C18H16ClF4N3O4 |
| Molecular Weight | 449.79 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-5-[(Z)-1-(dimethylamino)-4,4,4-trifluoro-3-oxobut-1-en-2-yl]-N-methoxy-N-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CON(C)C(=O)c1c(-c2c(F)cccc2Cl)noc1/C(=C/N(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H16ClF4N3O4/c1-25(2)8-9(16(27)18(21,22)23)15-13(17(28)26(3)29-4)14(24-30-15)12-10(19)6-5-7-11(12)20/h5-8H,1-4H3/b9-8- |
| InChIKey | IBUZAQDORFIOSN-HJWRWDBZSA-N |
| XLogP | 3.80 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|