C15H30N2O3P+ — CID 88850238
[2-ethyl-2-(3-hexylimidazol-3-ium-1-yl)butyl]phosphonic acid (PubChem CID 88850238) has the molecular formula C15H30N2O3P+ and a molecular weight of 317.39 g/mol. Its IUPAC name is [2-ethyl-2-(3-hexylimidazol-3-ium-1-yl)butyl]phosphonic acid.
| Compound Name | [2-ethyl-2-(3-hexylimidazol-3-ium-1-yl)butyl]phosphonic acid |
|---|---|
| PubChem CID | 88850238 |
| Molecular Formula | C15H30N2O3P+ |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [2-ethyl-2-(3-hexylimidazol-3-ium-1-yl)butyl]phosphonic acid |
| SMILES | CCCCCC[n+]1ccn(C(CC)(CC)CP(=O)(O)O)c1 |
| InChI | InChI=1S/C15H29N2O3P/c1-4-7-8-9-10-16-11-12-17(14-16)15(5-2,6-3)13-21(18,19)20/h11-12,14H,4-10,13H2,1-3H3,(H-,18,19,20)/p+1 |
| InChIKey | VDHDUVIJGHXJIE-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 66.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|