About methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate
methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate (PubChem CID 88850339) has the molecular formula C18H11ClN2O3
and a molecular weight of 338.75 g/mol. Its IUPAC name is methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate.
Molecular Properties
| Compound Name | methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate |
| PubChem CID | 88850339 |
| Molecular Formula | C18H11ClN2O3 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate |
| SMILES | COC(=O)c1cc(Cl)nc2ccc3nc(-c4ccccc4)oc3c12 |
| InChI | InChI=1S/C18H11ClN2O3/c1-23-18(22)11-9-14(19)20-12-7-8-13-16(15(11)12)24-17(21-13)10-5-3-2-4-6-10/h2-9H,1H3 |
| InChIKey | YZWFMLXWMREAQN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate?
The IUPAC name of methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate (CID 88850339) is methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate.
What is the SMILES notation for methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate?
The canonical SMILES for methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate is COC(=O)c1cc(Cl)nc2ccc3nc(-c4ccccc4)oc3c12.
What is the InChIKey of methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate?
The InChIKey is YZWFMLXWMREAQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11ClN2O3/c1-23-18(22)11-9-14(19)20-12-7-8-13-16(15(11)12)24-17(21-13)10-5-3-2-4-6-10/h2-9H,1H3.
What are the key properties of methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate?
methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate has a molecular weight of 338.75 g/mol, XLogP of 4.48, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-chloro-2-phenyl-[1,3]oxazolo[5,4-f]quinoline-9-carboxylate is sourced from PubChem (CID 88850339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).