About methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate
methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate (PubChem CID 88850417) has the molecular formula C19H15N3O10S
and a molecular weight of 477.41 g/mol. Its IUPAC name is methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate |
| PubChem CID | 88850417 |
| Molecular Formula | C19H15N3O10S |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)c2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2oc1=O |
| InChI | InChI=1S/C19H15N3O10S/c1-10-13-5-3-11(7-16(13)32-19(24)14(10)9-18(23)31-2)20-33(29,30)17-6-4-12(21(25)26)8-15(17)22(27)28/h3-8,20H,9H2,1-2H3 |
| InChIKey | CBDYXMIUBQYNHB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 188.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate?
The IUPAC name of methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate (CID 88850417) is methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate.
What is the SMILES notation for methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate?
The canonical SMILES for methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate is COC(=O)Cc1c(C)c2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2oc1=O.
What is the InChIKey of methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate?
The InChIKey is CBDYXMIUBQYNHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O10S/c1-10-13-5-3-11(7-16(13)32-19(24)14(10)9-18(23)31-2)20-33(29,30)17-6-4-12(21(25)26)8-15(17)22(27)28/h3-8,20H,9H2,1-2H3.
What are the key properties of methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate?
methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate has a molecular weight of 477.41 g/mol, XLogP of 2.43, 7 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetate is sourced from PubChem (CID 88850417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).