About 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid
2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid (PubChem CID 88850425) has the molecular formula C18H13N3O10S
and a molecular weight of 463.38 g/mol. Its IUPAC name is 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid |
| PubChem CID | 88850425 |
| Molecular Formula | C18H13N3O10S |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c(=O)oc2cc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C18H13N3O10S/c1-9-12-4-2-10(6-15(12)31-18(24)13(9)8-17(22)23)19-32(29,30)16-5-3-11(20(25)26)7-14(16)21(27)28/h2-7,19H,8H2,1H3,(H,22,23) |
| InChIKey | OYAGWCVQICTKKG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 199.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid?
The IUPAC name of 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid (CID 88850425) is 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid.
What is the SMILES notation for 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid?
The canonical SMILES for 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid is Cc1c(CC(=O)O)c(=O)oc2cc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])ccc12.
What is the InChIKey of 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid?
The InChIKey is OYAGWCVQICTKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O10S/c1-9-12-4-2-10(6-15(12)31-18(24)13(9)8-17(22)23)19-32(29,30)16-5-3-11(20(25)26)7-14(16)21(27)28/h2-7,19H,8H2,1H3,(H,22,23).
What are the key properties of 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid?
2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid has a molecular weight of 463.38 g/mol, XLogP of 2.35, 7 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-[(2,4-dinitrophenyl)sulfonylamino]-4-methyl-2-oxochromen-3-yl]acetic acid is sourced from PubChem (CID 88850425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).