About hexadec-4-ene-1,2,3-triol
hexadec-4-ene-1,2,3-triol (PubChem CID 88850447) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is hexadec-4-ene-1,2,3-triol.
Molecular Properties
| Compound Name | hexadec-4-ene-1,2,3-triol |
| PubChem CID | 88850447 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | hexadec-4-ene-1,2,3-triol |
| SMILES | CCCCCCCCCCCC=CC(O)C(O)CO |
| InChI | InChI=1S/C16H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(18)16(19)14-17/h12-13,15-19H,2-11,14H2,1H3 |
| InChIKey | UHPYYWNMKAADHT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hexadec-4-ene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadec-4-ene-1,2,3-triol?
The IUPAC name of hexadec-4-ene-1,2,3-triol (CID 88850447) is hexadec-4-ene-1,2,3-triol.
What is the SMILES notation for hexadec-4-ene-1,2,3-triol?
The canonical SMILES for hexadec-4-ene-1,2,3-triol is CCCCCCCCCCCC=CC(O)C(O)CO.
What is the InChIKey of hexadec-4-ene-1,2,3-triol?
The InChIKey is UHPYYWNMKAADHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(18)16(19)14-17/h12-13,15-19H,2-11,14H2,1H3.
What are the key properties of hexadec-4-ene-1,2,3-triol?
hexadec-4-ene-1,2,3-triol has a molecular weight of 272.43 g/mol, XLogP of 3.18, 13 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexadec-4-ene-1,2,3-triol is sourced from PubChem (CID 88850447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).