About [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite
[4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite (PubChem CID 88850568) has the molecular formula C44H44O6P2
and a molecular weight of 730.78 g/mol. Its IUPAC name is [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite.
Molecular Properties
| Compound Name | [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite |
| PubChem CID | 88850568 |
| Molecular Formula | C44H44O6P2 |
| Molecular Weight | 730.78 g/mol |
| Exact Mass | 730.26 |
| IUPAC Name | [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite |
| SMILES | Cc1cccc(C)c1OP(Oc1ccc(-c2ccc(OP(Oc3c(C)cccc3C)Oc3c(C)cccc3C)cc2)cc1)Oc1c(C)cccc1C |
| InChI | InChI=1S/C44H44O6P2/c1-29-13-9-14-30(2)41(29)47-51(48-42-31(3)15-10-16-32(42)4)45-39-25-21-37(22-26-39)38-23-27-40(28-24-38)46-52(49-43-33(5)17-11-18-34(43)6)50-44-35(7)19-12-20-36(44)8/h9-28H,1-8H3 |
| InChIKey | WZMRKLJZGGBSFV-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 730.78 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite?
The IUPAC name of [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite (CID 88850568) is [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite.
What is the SMILES notation for [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite?
The canonical SMILES for [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite is Cc1cccc(C)c1OP(Oc1ccc(-c2ccc(OP(Oc3c(C)cccc3C)Oc3c(C)cccc3C)cc2)cc1)Oc1c(C)cccc1C.
What is the InChIKey of [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite?
The InChIKey is WZMRKLJZGGBSFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H44O6P2/c1-29-13-9-14-30(2)41(29)47-51(48-42-31(3)15-10-16-32(42)4)45-39-25-21-37(22-26-39)38-23-27-40(28-24-38)46-52(49-43-33(5)17-11-18-34(43)6)50-44-35(7)19-12-20-36(44)8/h9-28H,1-8H3.
What are the key properties of [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite?
[4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite has a molecular weight of 730.78 g/mol, XLogP of 13.35, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-bis(2,6-dimethylphenoxy)phosphanyloxyphenyl]phenyl] bis(2,6-dimethylphenyl) phosphite is sourced from PubChem (CID 88850568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).