About tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane
tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane (PubChem CID 88851376) has the molecular formula C22H31ClN4OSi
and a molecular weight of 431.06 g/mol. Its IUPAC name is tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane |
| PubChem CID | 88851376 |
| Molecular Formula | C22H31ClN4OSi |
| Molecular Weight | 431.06 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane |
| SMILES | C[C@H]([C@@H](CCc1ccccc1)O[Si](C)(C)C(C)(C)C)n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C22H31ClN4OSi/c1-16(27-15-26-19-20(23)24-14-25-21(19)27)18(28-29(5,6)22(2,3)4)13-12-17-10-8-7-9-11-17/h7-11,14-16,18H,12-13H2,1-6H3/t16-,18-/m1/s1 |
| InChIKey | MPAYZPIEXPVSSS-SJLPKXTDSA-N |
| XLogP | 6.06 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.06 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane (CID 88851376) is tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane is C[C@H]([C@@H](CCc1ccccc1)O[Si](C)(C)C(C)(C)C)n1cnc2c(Cl)ncnc21.
What is the InChIKey of tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane?
The InChIKey is MPAYZPIEXPVSSS-SJLPKXTDSA-N. The full InChI is InChI=1S/C22H31ClN4OSi/c1-16(27-15-26-19-20(23)24-14-25-21(19)27)18(28-29(5,6)22(2,3)4)13-12-17-10-8-7-9-11-17/h7-11,14-16,18H,12-13H2,1-6H3/t16-,18-/m1/s1.
What are the key properties of tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane?
tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane has a molecular weight of 431.06 g/mol, XLogP of 6.06, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(3R,4R)-4-(6-chloropurin-9-yl)-1-phenylpentan-3-yl]oxy-dimethylsilane is sourced from PubChem (CID 88851376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).